C33H46N2O6 — CID 25073858
1,7-bis[4-hydroxy-3-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-4,4-dimethylheptane-3,5-dione (PubChem CID 25073858) has the molecular formula C33H46N2O6 and a molecular weight of 566.74 g/mol. Its IUPAC name is 1,7-bis[4-hydroxy-3-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-4,4-dimethylheptane-3,5-dione.
| Compound Name | 1,7-bis[4-hydroxy-3-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-4,4-dimethylheptane-3,5-dione |
|---|---|
| PubChem CID | 25073858 |
| Molecular Formula | C33H46N2O6 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 1,7-bis[4-hydroxy-3-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-4,4-dimethylheptane-3,5-dione |
| SMILES | COc1cc(CCC(=O)C(C)(C)C(=O)CCc2cc(CN3CCCC3)c(O)c(OC)c2)cc(CN2CCCC2)c1O |
| InChI | InChI=1S/C33H46N2O6/c1-33(2,29(36)11-9-23-17-25(21-34-13-5-6-14-34)31(38)27(19-23)40-3)30(37)12-10-24-18-26(22-35-15-7-8-16-35)32(39)28(20-24)41-4/h17-20,38-39H,5-16,21-22H2,1-4H3 |
| InChIKey | LDKDUIFBTTUDSR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|