C18H27NO7 — CID 23724185
oxalic acid;1-[(3,4,5-trimethoxyphenyl)methyl]azepane (PubChem CID 23724185) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is oxalic acid;1-[(3,4,5-trimethoxyphenyl)methyl]azepane.
| Compound Name | oxalic acid;1-[(3,4,5-trimethoxyphenyl)methyl]azepane |
|---|---|
| PubChem CID | 23724185 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | oxalic acid;1-[(3,4,5-trimethoxyphenyl)methyl]azepane |
| SMILES | COc1cc(CN2CCCCCC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H25NO3.C2H2O4/c1-18-14-10-13(11-15(19-2)16(14)20-3)12-17-8-6-4-5-7-9-17;3-1(4)2(5)6/h10-11H,4-9,12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | HJUFIAAZMGQBDH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|