C23H34N2O8 — CID 2903448
oxalic acid;piperidin-1-yl-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]methanone (PubChem CID 2903448) has the molecular formula C23H34N2O8 and a molecular weight of 466.53 g/mol. Its IUPAC name is oxalic acid;piperidin-1-yl-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]methanone.
| Compound Name | oxalic acid;piperidin-1-yl-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 2903448 |
| Molecular Formula | C23H34N2O8 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | oxalic acid;piperidin-1-yl-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]methanone |
| SMILES | COc1cc(CN2CCC(C(=O)N3CCCCC3)CC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H32N2O4.C2H2O4/c1-25-18-13-16(14-19(26-2)20(18)27-3)15-22-11-7-17(8-12-22)21(24)23-9-5-4-6-10-23;3-1(4)2(5)6/h13-14,17H,4-12,15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | XKQVNONUCWUOFU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|