C23H24O8 — CID 56940959
(3E,5E)-3,5-bis[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]oxan-4-one (PubChem CID 56940959) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]oxan-4-one.
| Compound Name | (3E,5E)-3,5-bis[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]oxan-4-one |
|---|---|
| PubChem CID | 56940959 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (3E,5E)-3,5-bis[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]oxan-4-one |
| SMILES | COc1cc(/C=C2\COC/C(=C\c3cc(OC)c(O)c(OC)c3)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C23H24O8/c1-27-17-7-13(8-18(28-2)22(17)25)5-15-11-31-12-16(21(15)24)6-14-9-19(29-3)23(26)20(10-14)30-4/h5-10,25-26H,11-12H2,1-4H3/b15-5+,16-6+ |
| InChIKey | CLBHDGUZMZFUBV-IAGONARPSA-N |
| XLogP | 3.20 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|