C19H16O6 — CID 6474889
(3E,5E)-3,5-bis[(3,4-dihydroxyphenyl)methylidene]oxan-4-one (PubChem CID 6474889) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-dihydroxyphenyl)methylidene]oxan-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3,4-dihydroxyphenyl)methylidene]oxan-4-one |
|---|---|
| PubChem CID | 6474889 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-dihydroxyphenyl)methylidene]oxan-4-one |
| SMILES | O=C1/C(=C/c2ccc(O)c(O)c2)COC/C1=C\c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H16O6/c20-15-3-1-11(7-17(15)22)5-13-9-25-10-14(19(13)24)6-12-2-4-16(21)18(23)8-12/h1-8,20-23H,9-10H2/b13-5+,14-6+ |
| InChIKey | WJXMHIODWHBGHP-ACFHMISVSA-N |
| XLogP | 2.58 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|