C24H22N2O10S2 — CID 158844505
5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 158844505) has the molecular formula C24H22N2O10S2 and a molecular weight of 562.58 g/mol. Its IUPAC name is 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 158844505 |
| Molecular Formula | C24H22N2O10S2 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)cc(OC)c1O.COc1cc(C=C2SC(=O)NC2=O)cc(OC)c1O |
| InChI | InChI=1S/2C12H11NO5S/c2*1-17-7-3-6(4-8(18-2)10(7)14)5-9-11(15)13-12(16)19-9/h2*3-5,14H,1-2H3,(H,13,15,16) |
| InChIKey | IYQQANYAWAZHFZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|