C25H29NO4S — CID 74062718
5-[[3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 74062718) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 5-[[3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 74062718 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 5-[[3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C=C2SC(=O)NC2=O)cc1-c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H29NO4S/c1-24(2,3)17-12-15(13-18(21(17)27)25(4,5)6)16-10-14(8-9-19(16)30-7)11-20-22(28)26-23(29)31-20/h8-13,27H,1-7H3,(H,26,28,29) |
| InChIKey | SNKAAIHFRUNSJW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|