C11H8N2O6S — CID 124664112
(5E)-5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124664112) has the molecular formula C11H8N2O6S and a molecular weight of 296.26 g/mol. Its IUPAC name is (5E)-5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124664112 |
| Molecular Formula | C11H8N2O6S |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | (5E)-5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=C2/SC(=O)NC2=O)c1O |
| InChI | InChI=1S/C11H8N2O6S/c1-19-7-4-6(13(17)18)2-5(9(7)14)3-8-10(15)12-11(16)20-8/h2-4,14H,1H3,(H,12,15,16)/b8-3+ |
| InChIKey | NPXGNSKYOPJSER-FPYGCLRLSA-N |
| XLogP | 1.63 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|