C14H12N2O5S2 — CID 18773802
(5E)-5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18773802) has the molecular formula C14H12N2O5S2 and a molecular weight of 352.39 g/mol. Its IUPAC name is (5E)-5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18773802 |
| Molecular Formula | C14H12N2O5S2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (5E)-5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C\c2cc([N+](=O)[O-])cc(OC)c2O)SC1=S |
| InChI | InChI=1S/C14H12N2O5S2/c1-3-4-15-13(18)11(23-14(15)22)6-8-5-9(16(19)20)7-10(21-2)12(8)17/h3,5-7,17H,1,4H2,2H3/b11-6+ |
| InChIKey | HIEZJZQVCGCDKH-IZZDOVSWSA-N |
| XLogP | 2.70 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|