C29H35N3O3 — CID 127028721
(3E,5E)-3,5-bis[[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylidene]piperidin-4-one (PubChem CID 127028721) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 127028721 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | (3E,5E)-3,5-bis[[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylidene]piperidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(O)c(CN3CCCC3)c2)CNC/C1=C\c1ccc(O)c(CN2CCCC2)c1 |
| InChI | InChI=1S/C29H35N3O3/c33-27-7-5-21(15-25(27)19-31-9-1-2-10-31)13-23-17-30-18-24(29(23)35)14-22-6-8-28(34)26(16-22)20-32-11-3-4-12-32/h5-8,13-16,30,33-34H,1-4,9-12,17-20H2/b23-13+,24-14+ |
| InChIKey | LZFQBOCBJMRBRI-RNIAWFEPSA-N |
| XLogP | 3.93 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|