C24H36N4O4 — CID 170349898
2-[[8-[(2,5-dihydroxyphenyl)methyl]-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]benzene-1,4-diol (PubChem CID 170349898) has the molecular formula C24H36N4O4 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[[8-[(2,5-dihydroxyphenyl)methyl]-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]benzene-1,4-diol.
| Compound Name | 2-[[8-[(2,5-dihydroxyphenyl)methyl]-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 170349898 |
| Molecular Formula | C24H36N4O4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 2-[[8-[(2,5-dihydroxyphenyl)methyl]-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(CN2CCCNCCN(Cc3cc(O)ccc3O)CCCNCC2)c1 |
| InChI | InChI=1S/C24H36N4O4/c29-21-3-5-23(31)19(15-21)17-27-11-1-7-25-9-14-28(12-2-8-26-10-13-27)18-20-16-22(30)4-6-24(20)32/h3-6,15-16,25-26,29-32H,1-2,7-14,17-18H2 |
| InChIKey | KYTOUTANIKEHSU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|