C12H18N2O2 — CID 61057832
4-(1,4-diazepan-1-ylmethyl)benzene-1,3-diol (PubChem CID 61057832) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-ylmethyl)benzene-1,3-diol.
| Compound Name | 4-(1,4-diazepan-1-ylmethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 61057832 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-(1,4-diazepan-1-ylmethyl)benzene-1,3-diol |
| SMILES | Oc1ccc(CN2CCCNCC2)c(O)c1 |
| InChI | InChI=1S/C12H18N2O2/c15-11-3-2-10(12(16)8-11)9-14-6-1-4-13-5-7-14/h2-3,8,13,15-16H,1,4-7,9H2 |
| InChIKey | XXLCYOZUYKLPHW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|