C11H16N2O3 — CID 12900434
4-(piperazin-1-ylmethyl)benzene-1,2,3-triol (PubChem CID 12900434) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-(piperazin-1-ylmethyl)benzene-1,2,3-triol.
| Compound Name | 4-(piperazin-1-ylmethyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 12900434 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 4-(piperazin-1-ylmethyl)benzene-1,2,3-triol |
| SMILES | Oc1ccc(CN2CCNCC2)c(O)c1O |
| InChI | InChI=1S/C11H16N2O3/c14-9-2-1-8(10(15)11(9)16)7-13-5-3-12-4-6-13/h1-2,12,14-16H,3-7H2 |
| InChIKey | ZMJTWUCZKIMYCP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|