C31H40N4O6 — CID 16722591
(1E,6E)-1,7-bis[4-hydroxy-3-methoxy-5-(piperazin-1-ylmethyl)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 16722591) has the molecular formula C31H40N4O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is (1E,6E)-1,7-bis[4-hydroxy-3-methoxy-5-(piperazin-1-ylmethyl)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis[4-hydroxy-3-methoxy-5-(piperazin-1-ylmethyl)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 16722591 |
| Molecular Formula | C31H40N4O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | (1E,6E)-1,7-bis[4-hydroxy-3-methoxy-5-(piperazin-1-ylmethyl)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2cc(CN3CCNCC3)c(O)c(OC)c2)cc(CN2CCNCC2)c1O |
| InChI | InChI=1S/C31H40N4O6/c1-40-28-17-22(15-24(30(28)38)20-34-11-7-32-8-12-34)3-5-26(36)19-27(37)6-4-23-16-25(31(39)29(18-23)41-2)21-35-13-9-33-10-14-35/h3-6,15-18,32-33,38-39H,7-14,19-21H2,1-2H3/b5-3+,6-4+ |
| InChIKey | ZVWKQASMBMCNFL-GGWOSOGESA-N |
| XLogP | 2.18 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|