C18H26N2O7 — CID 25153728
(E)-but-2-enedioic acid;1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (PubChem CID 25153728) has the molecular formula C18H26N2O7 and a molecular weight of 382.41 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[(2,3,4-trimethoxyphenyl)methyl]piperazine.
| Compound Name | (E)-but-2-enedioic acid;1-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 25153728 |
| Molecular Formula | C18H26N2O7 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCNCC2)c(OC)c1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H22N2O3.C4H4O4/c1-17-12-5-4-11(13(18-2)14(12)19-3)10-16-8-6-15-7-9-16;5-3(6)1-2-4(7)8/h4-5,15H,6-10H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HVPSNXJPICZRII-WLHGVMLRSA-N |
| XLogP | 0.83 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|