C41H60N2O12S — CID 162316273
bis((E)-but-2-enedioic acid);2,6-ditert-butyl-4-[2-methyl-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butan-2-yl]sulfanylphenol (PubChem CID 162316273) has the molecular formula C41H60N2O12S and a molecular weight of 805.00 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);2,6-ditert-butyl-4-[2-methyl-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butan-2-yl]sulfanylphenol.
| Compound Name | bis((E)-but-2-enedioic acid);2,6-ditert-butyl-4-[2-methyl-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butan-2-yl]sulfanylphenol |
|---|---|
| PubChem CID | 162316273 |
| Molecular Formula | C41H60N2O12S |
| Molecular Weight | 805.00 g/mol |
| Exact Mass | 804.39 |
| IUPAC Name | bis((E)-but-2-enedioic acid);2,6-ditert-butyl-4-[2-methyl-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butan-2-yl]sulfanylphenol |
| SMILES | COc1ccc(CN2CCN(CCC(C)(C)Sc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)CC2)c(OC)c1OC.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C33H52N2O4S.2C4H4O4/c1-31(2,3)25-20-24(21-26(28(25)36)32(4,5)6)40-33(7,8)14-15-34-16-18-35(19-17-34)22-23-12-13-27(37-9)30(39-11)29(23)38-10;2*5-3(6)1-2-4(7)8/h12-13,20-21,36H,14-19,22H2,1-11H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | HLYQSDLOYNEHOB-LVEZLNDCSA-N |
| XLogP | 6.52 |
| TPSA | 203.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.00 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|