C26H37N3O6 — CID 174596109
3-amino-4-[2-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]ethyl]benzoic acid (PubChem CID 174596109) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is 3-amino-4-[2-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]ethyl]benzoic acid.
| Compound Name | 3-amino-4-[2-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]ethyl]benzoic acid |
|---|---|
| PubChem CID | 174596109 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 3-amino-4-[2-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]ethyl]benzoic acid |
| SMILES | COc1ccc(CN2CCN(CCCOCCc3ccc(C(=O)O)cc3N)CC2)c(OC)c1OC |
| InChI | InChI=1S/C26H37N3O6/c1-32-23-8-7-21(24(33-2)25(23)34-3)18-29-13-11-28(12-14-29)10-4-15-35-16-9-19-5-6-20(26(30)31)17-22(19)27/h5-8,17H,4,9-16,18,27H2,1-3H3,(H,30,31) |
| InChIKey | JDBRAYAMALBWQN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|