C23H31BrClN5O4 — CID 174535228
4-bromo-N-(diaminomethylidene)-3-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide;hydrochloride (PubChem CID 174535228) has the molecular formula C23H31BrClN5O4 and a molecular weight of 556.89 g/mol. Its IUPAC name is 4-bromo-N-(diaminomethylidene)-3-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide;hydrochloride.
| Compound Name | 4-bromo-N-(diaminomethylidene)-3-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 174535228 |
| Molecular Formula | C23H31BrClN5O4 |
| Molecular Weight | 556.89 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 4-bromo-N-(diaminomethylidene)-3-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide;hydrochloride |
| SMILES | COc1ccc(CN2CCN(Cc3cc(C(=O)N=C(N)N)ccc3Br)CC2)c(OC)c1OC.Cl |
| InChI | InChI=1S/C23H30BrN5O4.ClH/c1-31-19-7-5-16(20(32-2)21(19)33-3)13-28-8-10-29(11-9-28)14-17-12-15(4-6-18(17)24)22(30)27-23(25)26;/h4-7,12H,8-11,13-14H2,1-3H3,(H4,25,26,27,30);1H |
| InChIKey | FVVIKGOQYVGSLI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.89 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|