C26H35N5O6 — CID 57326443
N-(diaminomethylidene)-2-ethoxy-5-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]acetyl]benzamide (PubChem CID 57326443) has the molecular formula C26H35N5O6 and a molecular weight of 513.60 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethoxy-5-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]acetyl]benzamide.
| Compound Name | N-(diaminomethylidene)-2-ethoxy-5-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]acetyl]benzamide |
|---|---|
| PubChem CID | 57326443 |
| Molecular Formula | C26H35N5O6 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | N-(diaminomethylidene)-2-ethoxy-5-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]acetyl]benzamide |
| SMILES | CCOc1ccc(C(=O)CN2CCN(Cc3ccc(OC)c(OC)c3OC)CC2)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C26H35N5O6/c1-5-37-21-8-6-17(14-19(21)25(33)29-26(27)28)20(32)16-31-12-10-30(11-13-31)15-18-7-9-22(34-2)24(36-4)23(18)35-3/h6-9,14H,5,10-13,15-16H2,1-4H3,(H4,27,28,29,33) |
| InChIKey | IEAMJZHQUACTHV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|