C24H33N5O6S — CID 174549208
N-(diaminomethylidene)-5-methylsulfonyl-2-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide (PubChem CID 174549208) has the molecular formula C24H33N5O6S and a molecular weight of 519.62 g/mol. Its IUPAC name is N-(diaminomethylidene)-5-methylsulfonyl-2-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide.
| Compound Name | N-(diaminomethylidene)-5-methylsulfonyl-2-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 174549208 |
| Molecular Formula | C24H33N5O6S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | N-(diaminomethylidene)-5-methylsulfonyl-2-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide |
| SMILES | COc1ccc(CN2CCN(Cc3ccc(S(C)(=O)=O)cc3C(=O)N=C(N)N)CC2)c(OC)c1OC |
| InChI | InChI=1S/C24H33N5O6S/c1-33-20-8-6-17(21(34-2)22(20)35-3)15-29-11-9-28(10-12-29)14-16-5-7-18(36(4,31)32)13-19(16)23(30)27-24(25)26/h5-8,13H,9-12,14-15H2,1-4H3,(H4,25,26,27,30) |
| InChIKey | IFWTVJZNCMXYKU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|