C23H32N6O6S — CID 174549203
N-carbamimidoyl-N-sulfamoyl-4-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide (PubChem CID 174549203) has the molecular formula C23H32N6O6S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-carbamimidoyl-N-sulfamoyl-4-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide.
| Compound Name | N-carbamimidoyl-N-sulfamoyl-4-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 174549203 |
| Molecular Formula | C23H32N6O6S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N-carbamimidoyl-N-sulfamoyl-4-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]benzamide |
| SMILES | [H]/N=C(\N)N(C(=O)c1ccc(CN2CCN(Cc3ccc(OC)c(OC)c3OC)CC2)cc1)S(N)(=O)=O |
| InChI | InChI=1S/C23H32N6O6S/c1-33-19-9-8-18(20(34-2)21(19)35-3)15-28-12-10-27(11-13-28)14-16-4-6-17(7-5-16)22(30)29(23(24)25)36(26,31)32/h4-9H,10-15H2,1-3H3,(H3,24,25)(H2,26,31,32) |
| InChIKey | YKFOWOKBPNZVJY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 164.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|