C30H42N4O6S4 — CID 88521116
[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbothioyl]sulfanyl 4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbodithioate (PubChem CID 88521116) has the molecular formula C30H42N4O6S4 and a molecular weight of 682.96 g/mol. Its IUPAC name is [4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbothioyl]sulfanyl 4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbodithioate.
| Compound Name | [4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbothioyl]sulfanyl 4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbodithioate |
|---|---|
| PubChem CID | 88521116 |
| Molecular Formula | C30H42N4O6S4 |
| Molecular Weight | 682.96 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | [4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbothioyl]sulfanyl 4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbodithioate |
| SMILES | COc1ccc(CN2CCN(C(=S)SSC(=S)N3CCN(Cc4ccc(OC)c(OC)c4OC)CC3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C30H42N4O6S4/c1-35-23-9-7-21(25(37-3)27(23)39-5)19-31-11-15-33(16-12-31)29(41)43-44-30(42)34-17-13-32(14-18-34)20-22-8-10-24(36-2)28(40-6)26(22)38-4/h7-10H,11-20H2,1-6H3 |
| InChIKey | DRKPMXWZEVKBSJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.96 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|