C18H28N2O5 — CID 23441394
tert-butyl 4-[(2-hydroxy-3,4-dimethoxyphenyl)methyl]piperazine-1-carboxylate (PubChem CID 23441394) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl 4-[(2-hydroxy-3,4-dimethoxyphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-hydroxy-3,4-dimethoxyphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23441394 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | tert-butyl 4-[(2-hydroxy-3,4-dimethoxyphenyl)methyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(CN2CCN(C(=O)OC(C)(C)C)CC2)c(O)c1OC |
| InChI | InChI=1S/C18H28N2O5/c1-18(2,3)25-17(22)20-10-8-19(9-11-20)12-13-6-7-14(23-4)16(24-5)15(13)21/h6-7,21H,8-12H2,1-5H3 |
| InChIKey | PGNUEPUSNYXXDO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|