C19H28N2O5 — CID 68844226
tert-butyl 4-[[2-hydroxy-5-(2-methoxy-2-oxoethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 68844226) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is tert-butyl 4-[[2-hydroxy-5-(2-methoxy-2-oxoethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-hydroxy-5-(2-methoxy-2-oxoethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68844226 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | tert-butyl 4-[[2-hydroxy-5-(2-methoxy-2-oxoethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | COC(=O)Cc1ccc(O)c(CN2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H28N2O5/c1-19(2,3)26-18(24)21-9-7-20(8-10-21)13-15-11-14(5-6-16(15)22)12-17(23)25-4/h5-6,11,22H,7-10,12-13H2,1-4H3 |
| InChIKey | HNJQQJSIPFVGAB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|