C21H31N3O2 — CID 171779755
tert-butyl 4-[[2-cyano-5-(2-methylpropyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 171779755) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is tert-butyl 4-[[2-cyano-5-(2-methylpropyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-cyano-5-(2-methylpropyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171779755 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | tert-butyl 4-[[2-cyano-5-(2-methylpropyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)Cc1ccc(C#N)c(CN2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H31N3O2/c1-16(2)12-17-6-7-18(14-22)19(13-17)15-23-8-10-24(11-9-23)20(25)26-21(3,4)5/h6-7,13,16H,8-12,15H2,1-5H3 |
| InChIKey | PFWRWIWDRGAQIG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |