C16H24N2O5 — CID 78857882
tert-butyl 4-[(2-methoxycarbonylfuran-3-yl)methyl]piperazine-1-carboxylate (PubChem CID 78857882) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl 4-[(2-methoxycarbonylfuran-3-yl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-methoxycarbonylfuran-3-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 78857882 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl 4-[(2-methoxycarbonylfuran-3-yl)methyl]piperazine-1-carboxylate |
| SMILES | COC(=O)c1occc1CN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H24N2O5/c1-16(2,3)23-15(20)18-8-6-17(7-9-18)11-12-5-10-22-13(12)14(19)21-4/h5,10H,6-9,11H2,1-4H3 |
| InChIKey | OTSUDERSKNPXIN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |