C40H54N4O6 — CID 118169351
tritert-butyl 10-(pyren-1-ylmethyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 118169351) has the molecular formula C40H54N4O6 and a molecular weight of 686.89 g/mol. Its IUPAC name is tritert-butyl 10-(pyren-1-ylmethyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tritert-butyl 10-(pyren-1-ylmethyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 118169351 |
| Molecular Formula | C40H54N4O6 |
| Molecular Weight | 686.89 g/mol |
| Exact Mass | 686.40 |
| IUPAC Name | tritert-butyl 10-(pyren-1-ylmethyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc3ccc4cccc5ccc2c3c45)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C40H54N4O6/c1-38(2,3)48-35(45)42-21-19-41(27-31-16-15-30-14-13-28-11-10-12-29-17-18-32(31)34(30)33(28)29)20-22-43(36(46)49-39(4,5)6)24-26-44(25-23-42)37(47)50-40(7,8)9/h10-18H,19-27H2,1-9H3 |
| InChIKey | FNAPGDPOLMAIKF-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 91.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.89 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|