C16H24ClN3O2 — CID 58105228
tert-butyl 4-[[6-(chloromethyl)-2-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 58105228) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is tert-butyl 4-[[6-(chloromethyl)-2-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-(chloromethyl)-2-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58105228 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | tert-butyl 4-[[6-(chloromethyl)-2-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cccc(CCl)n2)CC1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-16(2,3)22-15(21)20-9-7-19(8-10-20)12-14-6-4-5-13(11-17)18-14/h4-6H,7-12H2,1-3H3 |
| InChIKey | VOGOUMYNSQRQEM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|