C16H23N3O4 — CID 164890348
N-ethyl-4-[(5-formyl-2-hydroxy-3-methoxyphenyl)methyl]piperazine-1-carboxamide (PubChem CID 164890348) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-ethyl-4-[(5-formyl-2-hydroxy-3-methoxyphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-ethyl-4-[(5-formyl-2-hydroxy-3-methoxyphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 164890348 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-ethyl-4-[(5-formyl-2-hydroxy-3-methoxyphenyl)methyl]piperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(Cc2cc(C=O)cc(OC)c2O)CC1 |
| InChI | InChI=1S/C16H23N3O4/c1-3-17-16(22)19-6-4-18(5-7-19)10-13-8-12(11-20)9-14(23-2)15(13)21/h8-9,11,21H,3-7,10H2,1-2H3,(H,17,22) |
| InChIKey | PRDWWNPEEQWWFL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|