C14H21NO4 — CID 143409868
methanol;3-methoxy-4-(morpholin-4-ylmethyl)benzaldehyde (PubChem CID 143409868) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methanol;3-methoxy-4-(morpholin-4-ylmethyl)benzaldehyde.
| Compound Name | methanol;3-methoxy-4-(morpholin-4-ylmethyl)benzaldehyde |
|---|---|
| PubChem CID | 143409868 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methanol;3-methoxy-4-(morpholin-4-ylmethyl)benzaldehyde |
| SMILES | CO.COc1cc(C=O)ccc1CN1CCOCC1 |
| InChI | InChI=1S/C13H17NO3.CH4O/c1-16-13-8-11(10-15)2-3-12(13)9-14-4-6-17-7-5-14;1-2/h2-3,8,10H,4-7,9H2,1H3;2H,1H3 |
| InChIKey | BBEXIIRXNLUDRE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|