C26H36N4O9 — CID 72950986
7,13-bis[(2-methoxy-4-nitrophenyl)methyl]-1,4,10-trioxa-7,13-diazacyclopentadecane (PubChem CID 72950986) has the molecular formula C26H36N4O9 and a molecular weight of 548.59 g/mol. Its IUPAC name is 7,13-bis[(2-methoxy-4-nitrophenyl)methyl]-1,4,10-trioxa-7,13-diazacyclopentadecane.
| Compound Name | 7,13-bis[(2-methoxy-4-nitrophenyl)methyl]-1,4,10-trioxa-7,13-diazacyclopentadecane |
|---|---|
| PubChem CID | 72950986 |
| Molecular Formula | C26H36N4O9 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 7,13-bis[(2-methoxy-4-nitrophenyl)methyl]-1,4,10-trioxa-7,13-diazacyclopentadecane |
| SMILES | COc1cc([N+](=O)[O-])ccc1CN1CCOCCOCCN(Cc2ccc([N+](=O)[O-])cc2OC)CCOCC1 |
| InChI | InChI=1S/C26H36N4O9/c1-35-25-17-23(29(31)32)5-3-21(25)19-27-7-11-37-12-8-28(10-14-39-16-15-38-13-9-27)20-22-4-6-24(30(33)34)18-26(22)36-2/h3-6,17-18H,7-16,19-20H2,1-2H3 |
| InChIKey | JWJWRGHRKUKBKF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 138.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|