C17H22N4O4 — CID 30149597
5-[[4-[(2-methoxy-5-nitrophenyl)methyl]piperazin-1-yl]methyl]-3-methyl-1,2-oxazole (PubChem CID 30149597) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 5-[[4-[(2-methoxy-5-nitrophenyl)methyl]piperazin-1-yl]methyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[[4-[(2-methoxy-5-nitrophenyl)methyl]piperazin-1-yl]methyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 30149597 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 5-[[4-[(2-methoxy-5-nitrophenyl)methyl]piperazin-1-yl]methyl]-3-methyl-1,2-oxazole |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CCN(Cc2cc(C)no2)CC1 |
| InChI | InChI=1S/C17H22N4O4/c1-13-9-16(25-18-13)12-20-7-5-19(6-8-20)11-14-10-15(21(22)23)3-4-17(14)24-2/h3-4,9-10H,5-8,11-12H2,1-2H3 |
| InChIKey | AFOMXVNFUDGKAW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|