C19H22N2O5 — CID 77271766
4-[(2,4-dimethoxyphenyl)methyl]-2-(4-nitrophenyl)morpholine (PubChem CID 77271766) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methyl]-2-(4-nitrophenyl)morpholine.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methyl]-2-(4-nitrophenyl)morpholine |
|---|---|
| PubChem CID | 77271766 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methyl]-2-(4-nitrophenyl)morpholine |
| SMILES | COc1ccc(CN2CCOC(c3ccc([N+](=O)[O-])cc3)C2)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O5/c1-24-17-8-5-15(18(11-17)25-2)12-20-9-10-26-19(13-20)14-3-6-16(7-4-14)21(22)23/h3-8,11,19H,9-10,12-13H2,1-2H3 |
| InChIKey | STLXXOTVLUWZTP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|