About 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid
4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid (PubChem CID 174188144) has the molecular formula C20H20N2O8
and a molecular weight of 416.39 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid |
| PubChem CID | 174188144 |
| Molecular Formula | C20H20N2O8 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid |
| SMILES | COc1ccc(CN2C(=O)COC(C(=O)O)C2c2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C20H20N2O8/c1-28-15-8-5-13(16(9-15)29-2)10-21-17(23)11-30-19(20(24)25)18(21)12-3-6-14(7-4-12)22(26)27/h3-9,18-19H,10-11H2,1-2H3,(H,24,25) |
| InChIKey | YRZIUIGPJSRUQN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid?
The IUPAC name of 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid (CID 174188144) is 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid.
What is the SMILES notation for 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid?
The canonical SMILES for 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid is COc1ccc(CN2C(=O)COC(C(=O)O)C2c2ccc([N+](=O)[O-])cc2)c(OC)c1.
What is the InChIKey of 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid?
The InChIKey is YRZIUIGPJSRUQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O8/c1-28-15-8-5-13(16(9-15)29-2)10-21-17(23)11-30-19(20(24)25)18(21)12-3-6-14(7-4-12)22(26)27/h3-9,18-19H,10-11H2,1-2H3,(H,24,25).
What are the key properties of 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid?
4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid has a molecular weight of 416.39 g/mol, XLogP of 2.17, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)-5-oxomorpholine-2-carboxylic acid is sourced from PubChem (CID 174188144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).