C26H22F3N3O7 — CID 71054835
4-[(2,4-dimethoxyphenyl)methyl]-N-(4-nitrophenyl)-3-oxo-9-(trifluoromethyl)-5H-1,4-benzoxazepine-5-carboxamide (PubChem CID 71054835) has the molecular formula C26H22F3N3O7 and a molecular weight of 545.47 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methyl]-N-(4-nitrophenyl)-3-oxo-9-(trifluoromethyl)-5H-1,4-benzoxazepine-5-carboxamide.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methyl]-N-(4-nitrophenyl)-3-oxo-9-(trifluoromethyl)-5H-1,4-benzoxazepine-5-carboxamide |
|---|---|
| PubChem CID | 71054835 |
| Molecular Formula | C26H22F3N3O7 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methyl]-N-(4-nitrophenyl)-3-oxo-9-(trifluoromethyl)-5H-1,4-benzoxazepine-5-carboxamide |
| SMILES | COc1ccc(CN2C(=O)COc3c(cccc3C(F)(F)F)C2C(=O)Nc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C26H22F3N3O7/c1-37-18-11-6-15(21(12-18)38-2)13-31-22(33)14-39-24-19(4-3-5-20(24)26(27,28)29)23(31)25(34)30-16-7-9-17(10-8-16)32(35)36/h3-12,23H,13-14H2,1-2H3,(H,30,34) |
| InChIKey | YGEAKOWYMJHFKI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|