C46H40N4O11 — CID 139194868
4-[(2,4-dimethoxyphenyl)methyl-[4-[[4-[(2,4-dimethoxyphenyl)methyl-(4-nitrobenzoyl)amino]benzoyl]amino]benzoyl]amino]benzoic acid (PubChem CID 139194868) has the molecular formula C46H40N4O11 and a molecular weight of 824.84 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methyl-[4-[[4-[(2,4-dimethoxyphenyl)methyl-(4-nitrobenzoyl)amino]benzoyl]amino]benzoyl]amino]benzoic acid.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methyl-[4-[[4-[(2,4-dimethoxyphenyl)methyl-(4-nitrobenzoyl)amino]benzoyl]amino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 139194868 |
| Molecular Formula | C46H40N4O11 |
| Molecular Weight | 824.84 g/mol |
| Exact Mass | 824.27 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methyl-[4-[[4-[(2,4-dimethoxyphenyl)methyl-(4-nitrobenzoyl)amino]benzoyl]amino]benzoyl]amino]benzoic acid |
| SMILES | COc1ccc(CN(C(=O)c2ccc(NC(=O)c3ccc(N(Cc4ccc(OC)cc4OC)C(=O)c4ccc([N+](=O)[O-])cc4)cc3)cc2)c2ccc(C(=O)O)cc2)c(OC)c1 |
| InChI | InChI=1S/C46H40N4O11/c1-58-39-23-13-33(41(25-39)60-3)27-48(45(53)31-9-21-38(22-10-31)50(56)57)36-17-7-29(8-18-36)43(51)47-35-15-5-30(6-16-35)44(52)49(37-19-11-32(12-20-37)46(54)55)28-34-14-24-40(59-2)26-42(34)61-4/h5-26H,27-28H2,1-4H3,(H,47,51)(H,54,55) |
| InChIKey | ITOFFTUJHQQLJQ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 187.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.84 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|