C35H35N3O6 — CID 134997009
phenyl 4-[[4-[(4-nitrobenzoyl)-octylamino]benzoyl]amino]benzoate (PubChem CID 134997009) has the molecular formula C35H35N3O6 and a molecular weight of 593.68 g/mol. Its IUPAC name is phenyl 4-[[4-[(4-nitrobenzoyl)-octylamino]benzoyl]amino]benzoate.
| Compound Name | phenyl 4-[[4-[(4-nitrobenzoyl)-octylamino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 134997009 |
| Molecular Formula | C35H35N3O6 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | phenyl 4-[[4-[(4-nitrobenzoyl)-octylamino]benzoyl]amino]benzoate |
| SMILES | CCCCCCCCN(C(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(C(=O)Nc2ccc(C(=O)Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H35N3O6/c1-2-3-4-5-6-10-25-37(34(40)27-17-23-31(24-18-27)38(42)43)30-21-15-26(16-22-30)33(39)36-29-19-13-28(14-20-29)35(41)44-32-11-8-7-9-12-32/h7-9,11-24H,2-6,10,25H2,1H3,(H,36,39) |
| InChIKey | SOLDWDNRKZKXSB-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|