C34H36N4O5 — CID 42702781
N-[3-[N-[(4-nitrophenyl)carbamoyl]-4-phenoxyanilino]propyl]-4-pentylbenzamide (PubChem CID 42702781) has the molecular formula C34H36N4O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is N-[3-[N-[(4-nitrophenyl)carbamoyl]-4-phenoxyanilino]propyl]-4-pentylbenzamide.
| Compound Name | N-[3-[N-[(4-nitrophenyl)carbamoyl]-4-phenoxyanilino]propyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 42702781 |
| Molecular Formula | C34H36N4O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | N-[3-[N-[(4-nitrophenyl)carbamoyl]-4-phenoxyanilino]propyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)NCCCN(C(=O)Nc2ccc([N+](=O)[O-])cc2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H36N4O5/c1-2-3-5-9-26-12-14-27(15-13-26)33(39)35-24-8-25-37(34(40)36-28-16-18-30(19-17-28)38(41)42)29-20-22-32(23-21-29)43-31-10-6-4-7-11-31/h4,6-7,10-23H,2-3,5,8-9,24-25H2,1H3,(H,35,39)(H,36,40) |
| InChIKey | HMFJDWUUGXLQHK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|