C27H28N4O7 — CID 42708762
ethyl 4-[2-[N-[(4-nitrophenyl)carbamoyl]-4-phenoxyanilino]ethylamino]-4-oxobutanoate (PubChem CID 42708762) has the molecular formula C27H28N4O7 and a molecular weight of 520.54 g/mol. Its IUPAC name is ethyl 4-[2-[N-[(4-nitrophenyl)carbamoyl]-4-phenoxyanilino]ethylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-[N-[(4-nitrophenyl)carbamoyl]-4-phenoxyanilino]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42708762 |
| Molecular Formula | C27H28N4O7 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | ethyl 4-[2-[N-[(4-nitrophenyl)carbamoyl]-4-phenoxyanilino]ethylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NCCN(C(=O)Nc1ccc([N+](=O)[O-])cc1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N4O7/c1-2-37-26(33)17-16-25(32)28-18-19-30(27(34)29-20-8-10-22(11-9-20)31(35)36)21-12-14-24(15-13-21)38-23-6-4-3-5-7-23/h3-15H,2,16-19H2,1H3,(H,28,32)(H,29,34) |
| InChIKey | DQZRUWAJRYWGGS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|