C15H17N4O3+ — CID 7201824
2-[N-[(4-nitrophenyl)carbamoyl]anilino]ethylazanium (PubChem CID 7201824) has the molecular formula C15H17N4O3+ and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-[N-[(4-nitrophenyl)carbamoyl]anilino]ethylazanium.
| Compound Name | 2-[N-[(4-nitrophenyl)carbamoyl]anilino]ethylazanium |
|---|---|
| PubChem CID | 7201824 |
| Molecular Formula | C15H17N4O3+ |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[N-[(4-nitrophenyl)carbamoyl]anilino]ethylazanium |
| SMILES | [NH3+]CCN(C(=O)Nc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N4O3/c16-10-11-18(13-4-2-1-3-5-13)15(20)17-12-6-8-14(9-7-12)19(21)22/h1-9H,10-11,16H2,(H,17,20)/p+1 |
| InChIKey | CKAJRXLKKYUDJA-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|