C21H25FN4O4 — CID 42706929
N-[2-[4-fluoro-N-[(4-nitrophenyl)carbamoyl]anilino]ethyl]hexanamide (PubChem CID 42706929) has the molecular formula C21H25FN4O4 and a molecular weight of 416.45 g/mol. Its IUPAC name is N-[2-[4-fluoro-N-[(4-nitrophenyl)carbamoyl]anilino]ethyl]hexanamide.
| Compound Name | N-[2-[4-fluoro-N-[(4-nitrophenyl)carbamoyl]anilino]ethyl]hexanamide |
|---|---|
| PubChem CID | 42706929 |
| Molecular Formula | C21H25FN4O4 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[2-[4-fluoro-N-[(4-nitrophenyl)carbamoyl]anilino]ethyl]hexanamide |
| SMILES | CCCCCC(=O)NCCN(C(=O)Nc1ccc([N+](=O)[O-])cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN4O4/c1-2-3-4-5-20(27)23-14-15-25(18-10-6-16(22)7-11-18)21(28)24-17-8-12-19(13-9-17)26(29)30/h6-13H,2-5,14-15H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | HOBFOOBRKLSGFE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|