C23H28F3N3O2 — CID 4656137
N-[2-[N-[(4-methylphenyl)carbamoyl]-3-(trifluoromethyl)anilino]ethyl]hexanamide (PubChem CID 4656137) has the molecular formula C23H28F3N3O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[2-[N-[(4-methylphenyl)carbamoyl]-3-(trifluoromethyl)anilino]ethyl]hexanamide.
| Compound Name | N-[2-[N-[(4-methylphenyl)carbamoyl]-3-(trifluoromethyl)anilino]ethyl]hexanamide |
|---|---|
| PubChem CID | 4656137 |
| Molecular Formula | C23H28F3N3O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N-[2-[N-[(4-methylphenyl)carbamoyl]-3-(trifluoromethyl)anilino]ethyl]hexanamide |
| SMILES | CCCCCC(=O)NCCN(C(=O)Nc1ccc(C)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H28F3N3O2/c1-3-4-5-9-21(30)27-14-15-29(20-8-6-7-18(16-20)23(24,25)26)22(31)28-19-12-10-17(2)11-13-19/h6-8,10-13,16H,3-5,9,14-15H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | WGHODUUVNIRUNS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|