C25H31ClF3N3O2 — CID 4235291
N-[2-[N-[(4-chlorophenyl)carbamoyl]-3-(trifluoromethyl)anilino]ethyl]nonanamide (PubChem CID 4235291) has the molecular formula C25H31ClF3N3O2 and a molecular weight of 497.99 g/mol. Its IUPAC name is N-[2-[N-[(4-chlorophenyl)carbamoyl]-3-(trifluoromethyl)anilino]ethyl]nonanamide.
| Compound Name | N-[2-[N-[(4-chlorophenyl)carbamoyl]-3-(trifluoromethyl)anilino]ethyl]nonanamide |
|---|---|
| PubChem CID | 4235291 |
| Molecular Formula | C25H31ClF3N3O2 |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[2-[N-[(4-chlorophenyl)carbamoyl]-3-(trifluoromethyl)anilino]ethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCCN(C(=O)Nc1ccc(Cl)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H31ClF3N3O2/c1-2-3-4-5-6-7-11-23(33)30-16-17-32(22-10-8-9-19(18-22)25(27,28)29)24(34)31-21-14-12-20(26)13-15-21/h8-10,12-15,18H,2-7,11,16-17H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | NPBRCSGBYPYVAE-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|