C22H29ClN4O2 — CID 3946929
6-amino-N-[3-[N-[(4-chlorophenyl)carbamoyl]anilino]propyl]hexanamide (PubChem CID 3946929) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 6-amino-N-[3-[N-[(4-chlorophenyl)carbamoyl]anilino]propyl]hexanamide.
| Compound Name | 6-amino-N-[3-[N-[(4-chlorophenyl)carbamoyl]anilino]propyl]hexanamide |
|---|---|
| PubChem CID | 3946929 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 6-amino-N-[3-[N-[(4-chlorophenyl)carbamoyl]anilino]propyl]hexanamide |
| SMILES | NCCCCCC(=O)NCCCN(C(=O)Nc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H29ClN4O2/c23-18-11-13-19(14-12-18)26-22(29)27(20-8-3-1-4-9-20)17-7-16-25-21(28)10-5-2-6-15-24/h1,3-4,8-9,11-14H,2,5-7,10,15-17,24H2,(H,25,28)(H,26,29) |
| InChIKey | NOIBTBZVXBULCB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|