C24H25ClN4O2 — CID 42657176
3-(4-chlorophenyl)-1-[3-[(2-methylphenyl)carbamoylamino]propyl]-1-phenylurea (PubChem CID 42657176) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[3-[(2-methylphenyl)carbamoylamino]propyl]-1-phenylurea.
| Compound Name | 3-(4-chlorophenyl)-1-[3-[(2-methylphenyl)carbamoylamino]propyl]-1-phenylurea |
|---|---|
| PubChem CID | 42657176 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[3-[(2-methylphenyl)carbamoylamino]propyl]-1-phenylurea |
| SMILES | Cc1ccccc1NC(=O)NCCCN(C(=O)Nc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H25ClN4O2/c1-18-8-5-6-11-22(18)28-23(30)26-16-7-17-29(21-9-3-2-4-10-21)24(31)27-20-14-12-19(25)13-15-20/h2-6,8-15H,7,16-17H2,1H3,(H,27,31)(H2,26,28,30) |
| InChIKey | PIFKQUHRJPWWHY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|