C25H26ClN3O2 — CID 42705311
4-chloro-N-[3-[(4-ethylphenyl)carbamoylamino]propyl]-N-phenylbenzamide (PubChem CID 42705311) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 4-chloro-N-[3-[(4-ethylphenyl)carbamoylamino]propyl]-N-phenylbenzamide.
| Compound Name | 4-chloro-N-[3-[(4-ethylphenyl)carbamoylamino]propyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 42705311 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-chloro-N-[3-[(4-ethylphenyl)carbamoylamino]propyl]-N-phenylbenzamide |
| SMILES | CCc1ccc(NC(=O)NCCCN(C(=O)c2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26ClN3O2/c1-2-19-9-15-22(16-10-19)28-25(31)27-17-6-18-29(23-7-4-3-5-8-23)24(30)20-11-13-21(26)14-12-20/h3-5,7-16H,2,6,17-18H2,1H3,(H2,27,28,31) |
| InChIKey | CIXAAPGCHPQDJR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|