C23H20Cl3N3O2 — CID 42706747
2-chloro-N-[3-[(3,4-dichlorophenyl)carbamoylamino]propyl]-N-phenylbenzamide (PubChem CID 42706747) has the molecular formula C23H20Cl3N3O2 and a molecular weight of 476.79 g/mol. Its IUPAC name is 2-chloro-N-[3-[(3,4-dichlorophenyl)carbamoylamino]propyl]-N-phenylbenzamide.
| Compound Name | 2-chloro-N-[3-[(3,4-dichlorophenyl)carbamoylamino]propyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 42706747 |
| Molecular Formula | C23H20Cl3N3O2 |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2-chloro-N-[3-[(3,4-dichlorophenyl)carbamoylamino]propyl]-N-phenylbenzamide |
| SMILES | O=C(NCCCN(C(=O)c1ccccc1Cl)c1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H20Cl3N3O2/c24-19-10-5-4-9-18(19)22(30)29(17-7-2-1-3-8-17)14-6-13-27-23(31)28-16-11-12-20(25)21(26)15-16/h1-5,7-12,15H,6,13-14H2,(H2,27,28,31) |
| InChIKey | BCZAYRZCWRZZOM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|