C21H22Cl2N2O2 — CID 42706776
2,4-dichloro-N-[3-(cyclobutanecarbonylamino)propyl]-N-phenylbenzamide (PubChem CID 42706776) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(cyclobutanecarbonylamino)propyl]-N-phenylbenzamide.
| Compound Name | 2,4-dichloro-N-[3-(cyclobutanecarbonylamino)propyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 42706776 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2,4-dichloro-N-[3-(cyclobutanecarbonylamino)propyl]-N-phenylbenzamide |
| SMILES | O=C(NCCCN(C(=O)c1ccc(Cl)cc1Cl)c1ccccc1)C1CCC1 |
| InChI | InChI=1S/C21H22Cl2N2O2/c22-16-10-11-18(19(23)14-16)21(27)25(17-8-2-1-3-9-17)13-5-12-24-20(26)15-6-4-7-15/h1-3,8-11,14-15H,4-7,12-13H2,(H,24,26) |
| InChIKey | SHSBRVJYAWLFIS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|