C26H28Cl2N2O3S — CID 42706779
N-[3-[(4-tert-butylphenyl)sulfonylamino]propyl]-2,4-dichloro-N-phenylbenzamide (PubChem CID 42706779) has the molecular formula C26H28Cl2N2O3S and a molecular weight of 519.49 g/mol. Its IUPAC name is N-[3-[(4-tert-butylphenyl)sulfonylamino]propyl]-2,4-dichloro-N-phenylbenzamide.
| Compound Name | N-[3-[(4-tert-butylphenyl)sulfonylamino]propyl]-2,4-dichloro-N-phenylbenzamide |
|---|---|
| PubChem CID | 42706779 |
| Molecular Formula | C26H28Cl2N2O3S |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[3-[(4-tert-butylphenyl)sulfonylamino]propyl]-2,4-dichloro-N-phenylbenzamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCCN(C(=O)c2ccc(Cl)cc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28Cl2N2O3S/c1-26(2,3)19-10-13-22(14-11-19)34(32,33)29-16-7-17-30(21-8-5-4-6-9-21)25(31)23-15-12-20(27)18-24(23)28/h4-6,8-15,18,29H,7,16-17H2,1-3H3 |
| InChIKey | XWURVKWSMWAJDJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|