C26H28F2N2O3S — CID 42726216
N-[3-[(4-tert-butylphenyl)sulfonylamino]propyl]-4-fluoro-N-(4-fluorophenyl)benzamide (PubChem CID 42726216) has the molecular formula C26H28F2N2O3S and a molecular weight of 486.58 g/mol. Its IUPAC name is N-[3-[(4-tert-butylphenyl)sulfonylamino]propyl]-4-fluoro-N-(4-fluorophenyl)benzamide.
| Compound Name | N-[3-[(4-tert-butylphenyl)sulfonylamino]propyl]-4-fluoro-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 42726216 |
| Molecular Formula | C26H28F2N2O3S |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-[3-[(4-tert-butylphenyl)sulfonylamino]propyl]-4-fluoro-N-(4-fluorophenyl)benzamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCCN(C(=O)c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H28F2N2O3S/c1-26(2,3)20-7-15-24(16-8-20)34(32,33)29-17-4-18-30(23-13-11-22(28)12-14-23)25(31)19-5-9-21(27)10-6-19/h5-16,29H,4,17-18H2,1-3H3 |
| InChIKey | BSWCKJUSHQFDDX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|